C17H9BrI2N4O4S — CID 136715824
(2E,5E)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136715824) has the molecular formula C17H9BrI2N4O4S and a molecular weight of 699.06 g/mol. Its IUPAC name is (2E,5E)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136715824 |
| Molecular Formula | C17H9BrI2N4O4S |
| Molecular Weight | 699.06 g/mol |
| Exact Mass | 697.76 |
| IUPAC Name | (2E,5E)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C/c2cc(I)cc(I)c2O)S/C1=C/c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H9BrI2N4O4S/c18-11-2-1-8(3-13(11)24(27)28)4-14-16(26)22-17(29-14)23-21-7-9-5-10(19)6-12(20)15(9)25/h1-7,25H,(H,22,23,26)/b14-4+,21-7- |
| InChIKey | DNCMNILSPPKQFD-SCFFWXAASA-N |
| XLogP | 4.87 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|