C19H17N5O3S — CID 135824781
(2E,5E)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135824781) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is (2E,5E)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135824781 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2E,5E)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-5-[(3-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=N/N=C2\NC(=O)/C(=C\c3cccc([N+](=O)[O-])c3)S2)cc1 |
| InChI | InChI=1S/C19H17N5O3S/c1-23(2)15-8-6-13(7-9-15)12-20-22-19-21-18(25)17(28-19)11-14-4-3-5-16(10-14)24(26)27/h3-12H,1-2H3,(H,21,22,25)/b17-11+,20-12+ |
| InChIKey | MCWSPOUQBRKUCO-WYRLOYKNSA-N |
| XLogP | 3.25 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|