C20H19BrN4O2S — CID 136878217
(2Z,5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136878217) has the molecular formula C20H19BrN4O2S and a molecular weight of 459.37 g/mol. Its IUPAC name is (2Z,5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136878217 |
| Molecular Formula | C20H19BrN4O2S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (2Z,5E)-5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/S/C(=N\N=C/c3ccc(N(C)C)cc3)NC2=O)cc1Br |
| InChI | InChI=1S/C20H19BrN4O2S/c1-25(2)15-7-4-13(5-8-15)12-22-24-20-23-19(26)18(28-20)11-14-6-9-17(27-3)16(21)10-14/h4-12H,1-3H3,(H,23,24,26)/b18-11+,22-12- |
| InChIKey | PRBWNNKVOKERFB-NWRRRYSJSA-N |
| XLogP | 4.12 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|