C19H15Br2N3O3S — CID 135514953
5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(3-bromo-4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135514953) has the molecular formula C19H15Br2N3O3S and a molecular weight of 525.22 g/mol. Its IUPAC name is 5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(3-bromo-4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(3-bromo-4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135514953 |
| Molecular Formula | C19H15Br2N3O3S |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.92 |
| IUPAC Name | 5-[(3-bromo-4-methoxyphenyl)methylidene]-2-[(3-bromo-4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=NN=C2NC(=O)C(=Cc3ccc(OC)c(Br)c3)S2)cc1Br |
| InChI | InChI=1S/C19H15Br2N3O3S/c1-26-15-5-3-11(7-13(15)20)9-17-18(25)23-19(28-17)24-22-10-12-4-6-16(27-2)14(21)8-12/h3-10H,1-2H3,(H,23,24,25) |
| InChIKey | USOAHXRSMGCSNP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|