C10H6BrN3O3S — CID 154791245
(5Z)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 154791245) has the molecular formula C10H6BrN3O3S and a molecular weight of 328.15 g/mol. Its IUPAC name is (5Z)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154791245 |
| Molecular Formula | C10H6BrN3O3S |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | (5Z)-5-[(4-bromo-3-nitrophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccc(Br)c([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C10H6BrN3O3S/c11-6-2-1-5(3-7(6)14(16)17)4-8-9(15)13-10(12)18-8/h1-4H,(H2,12,13,15)/b8-4- |
| InChIKey | QMZMFQSCRVRMSU-YWEYNIOJSA-N |
| XLogP | 2.50 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|