C15H10N4O4S — CID 138376656
(5E)-2-imino-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 138376656) has the molecular formula C15H10N4O4S and a molecular weight of 342.34 g/mol. Its IUPAC name is (5E)-2-imino-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-imino-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 138376656 |
| Molecular Formula | C15H10N4O4S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (5E)-2-imino-5-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)/C(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc2)S1 |
| InChI | InChI=1S/C15H10N4O4S/c16-15-18-14(20)12(24-15)7-9-1-4-11(5-2-9)23-13-6-3-10(8-17-13)19(21)22/h1-8H,(H2,16,18,20)/b12-7+ |
| InChIKey | XWTBCBVPLDSBBI-KPKJPENVSA-N |
| XLogP | 2.92 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|