C17H10Br2ClN3O2S — CID 136914336
2-[(2-chlorophenyl)methylidenehydrazinylidene]-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136914336) has the molecular formula C17H10Br2ClN3O2S and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylidenehydrazinylidene]-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2-chlorophenyl)methylidenehydrazinylidene]-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136914336 |
| Molecular Formula | C17H10Br2ClN3O2S |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 512.85 |
| IUPAC Name | 2-[(2-chlorophenyl)methylidenehydrazinylidene]-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NN=Cc2ccccc2Cl)SC1=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C17H10Br2ClN3O2S/c18-11-5-10(15(24)12(19)7-11)6-14-16(25)22-17(26-14)23-21-8-9-3-1-2-4-13(9)20/h1-8,24H,(H,22,23,25) |
| InChIKey | GUHNGVPLBILIEP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|