C17H10Br2ClN3OS — CID 171980641
(2E,5Z)-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-5-[(2,5-dibromophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 171980641) has the molecular formula C17H10Br2ClN3OS and a molecular weight of 499.62 g/mol. Its IUPAC name is (2E,5Z)-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-5-[(2,5-dibromophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-5-[(2,5-dibromophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171980641 |
| Molecular Formula | C17H10Br2ClN3OS |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 496.86 |
| IUPAC Name | (2E,5Z)-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-5-[(2,5-dibromophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2ccccc2Cl)S/C1=C\c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H10Br2ClN3OS/c18-12-5-6-13(19)11(7-12)8-15-16(24)22-17(25-15)23-21-9-10-3-1-2-4-14(10)20/h1-9H,(H,22,23,24)/b15-8-,21-9+ |
| InChIKey | BRXJRSVXWQPCMD-CVTXJHAVSA-N |
| XLogP | 5.46 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|