C17H9BrCl2N2O3S — CID 135687818
(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135687818) has the molecular formula C17H9BrCl2N2O3S and a molecular weight of 472.15 g/mol. Its IUPAC name is (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135687818 |
| Molecular Formula | C17H9BrCl2N2O3S |
| Molecular Weight | 472.15 g/mol |
| Exact Mass | 469.89 |
| IUPAC Name | (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(Cl)c2Cl)S/C1=C/c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C17H9BrCl2N2O3S/c18-9-6-13-12(24-7-25-13)4-8(9)5-14-16(23)22-17(26-14)21-11-3-1-2-10(19)15(11)20/h1-6H,7H2,(H,21,22,23)/b14-5+ |
| InChIKey | YBWKYHIVVZSFOM-LHHJGKSTSA-N |
| XLogP | 5.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.15 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|