C20H14ClF3N2O4S — CID 135941560
2-[2-[(E)-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 135941560) has the molecular formula C20H14ClF3N2O4S and a molecular weight of 470.86 g/mol. Its IUPAC name is 2-[2-[(E)-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-[(E)-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 135941560 |
| Molecular Formula | C20H14ClF3N2O4S |
| Molecular Weight | 470.86 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 2-[2-[(E)-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccccc1/C=C1/S/C(=N/c2ccc(Cl)c(C(F)(F)F)c2)NC1=O)C(=O)O |
| InChI | InChI=1S/C20H14ClF3N2O4S/c1-10(18(28)29)30-15-5-3-2-4-11(15)8-16-17(27)26-19(31-16)25-12-6-7-14(21)13(9-12)20(22,23)24/h2-10H,1H3,(H,28,29)(H,25,26,27)/b16-8+ |
| InChIKey | DPNNTHQUDHCONA-LZYBPNLTSA-N |
| XLogP | 5.10 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|