C20H17BrN2O4S — CID 135941589
2-[2-[(E)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 135941589) has the molecular formula C20H17BrN2O4S and a molecular weight of 461.34 g/mol. Its IUPAC name is 2-[2-[(E)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-[(E)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 135941589 |
| Molecular Formula | C20H17BrN2O4S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-[2-[(E)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccccc1/C=C1/S/C(=N\c2ccc(Br)cc2)NC1=O)C(=O)O |
| InChI | InChI=1S/C20H17BrN2O4S/c1-2-15(19(25)26)27-16-6-4-3-5-12(16)11-17-18(24)23-20(28-17)22-14-9-7-13(21)8-10-14/h3-11,15H,2H2,1H3,(H,25,26)(H,22,23,24)/b17-11+ |
| InChIKey | IDUZTABHTVQGKC-GZTJUZNOSA-N |
| XLogP | 4.58 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|