C14H13NO4S2 — CID 43829045
2-[2-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid (PubChem CID 43829045) has the molecular formula C14H13NO4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[2-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43829045 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[2-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccccc1/C=C1/SC(=S)NC1=O)C(=O)O |
| InChI | InChI=1S/C14H13NO4S2/c1-2-9(13(17)18)19-10-6-4-3-5-8(10)7-11-12(16)15-14(20)21-11/h3-7,9H,2H2,1H3,(H,17,18)(H,15,16,20)/b11-7+ |
| InChIKey | MLTOAKNLMHTNJS-YRNVUSSQSA-N |
| XLogP | 2.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|