C20H19FN2OS — CID 135444255
5-[(4-tert-butylphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135444255) has the molecular formula C20H19FN2OS and a molecular weight of 354.45 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-tert-butylphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135444255 |
| Molecular Formula | C20H19FN2OS |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1ccc(C=C2S/C(=N\c3ccc(F)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H19FN2OS/c1-20(2,3)14-6-4-13(5-7-14)12-17-18(24)23-19(25-17)22-16-10-8-15(21)9-11-16/h4-12H,1-3H3,(H,22,23,24) |
| InChIKey | KUYVWVYUJNKCLI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|