C20H13BrN2O3S2 — CID 137289754
(NZ)-N-[(5E)-5-[(4-bromophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide (PubChem CID 137289754) has the molecular formula C20H13BrN2O3S2 and a molecular weight of 473.37 g/mol. Its IUPAC name is (NZ)-N-[(5E)-5-[(4-bromophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide.
| Compound Name | (NZ)-N-[(5E)-5-[(4-bromophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 137289754 |
| Molecular Formula | C20H13BrN2O3S2 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | (NZ)-N-[(5E)-5-[(4-bromophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide |
| SMILES | O=C1N/C(=N/S(=O)(=O)c2cccc3ccccc23)S/C1=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H13BrN2O3S2/c21-15-10-8-13(9-11-15)12-17-19(24)22-20(27-17)23-28(25,26)18-7-3-5-14-4-1-2-6-16(14)18/h1-12H,(H,22,23,24)/b17-12+ |
| InChIKey | CGDLWHGPJPVPDU-SFQUDFHCSA-N |
| XLogP | 4.55 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|