C27H17Br3N2O2S — CID 137020426
(5Z)-2-(4-bromophenyl)imino-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137020426) has the molecular formula C27H17Br3N2O2S and a molecular weight of 673.22 g/mol. Its IUPAC name is (5Z)-2-(4-bromophenyl)imino-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromophenyl)imino-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020426 |
| Molecular Formula | C27H17Br3N2O2S |
| Molecular Weight | 673.22 g/mol |
| Exact Mass | 669.86 |
| IUPAC Name | (5Z)-2-(4-bromophenyl)imino-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Br)cc2)S/C1=C\c1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C27H17Br3N2O2S/c28-19-8-10-20(11-9-19)31-27-32-26(33)24(35-27)14-16-12-22(29)25(23(30)13-16)34-15-18-6-3-5-17-4-1-2-7-21(17)18/h1-14H,15H2,(H,31,32,33)/b24-14- |
| InChIKey | ZSWWWFXTDIUXNM-OYKKKHCWSA-N |
| XLogP | 8.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.22 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|