C13H9Cl2N3O4S — CID 137214098
methyl (2E)-2-[2-[(2,4-dichlorobenzoyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 137214098) has the molecular formula C13H9Cl2N3O4S and a molecular weight of 374.21 g/mol. Its IUPAC name is methyl (2E)-2-[2-[(2,4-dichlorobenzoyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[2-[(2,4-dichlorobenzoyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 137214098 |
| Molecular Formula | C13H9Cl2N3O4S |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | methyl (2E)-2-[2-[(2,4-dichlorobenzoyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/SC(=NNC(=O)c2ccc(Cl)cc2Cl)NC1=O |
| InChI | InChI=1S/C13H9Cl2N3O4S/c1-22-10(19)5-9-12(21)16-13(23-9)18-17-11(20)7-3-2-6(14)4-8(7)15/h2-5H,1H3,(H,17,20)(H,16,18,21)/b9-5+ |
| InChIKey | SIAVRLCOOYZBLX-WEVVVXLNSA-N |
| XLogP | 1.91 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|