C15H11Cl2N3O5S — CID 172927132
methyl (2E)-2-[(2Z)-2-[(4-acetyloxy-2,6-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927132) has the molecular formula C15H11Cl2N3O5S and a molecular weight of 416.24 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(4-acetyloxy-2,6-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(4-acetyloxy-2,6-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927132 |
| Molecular Formula | C15H11Cl2N3O5S |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(4-acetyloxy-2,6-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2c(Cl)cc(OC(C)=O)cc2Cl)NC1=O |
| InChI | InChI=1S/C15H11Cl2N3O5S/c1-7(21)25-8-3-10(16)9(11(17)4-8)6-18-20-15-19-14(23)12(26-15)5-13(22)24-2/h3-6H,1-2H3,(H,19,20,23)/b12-5+,18-6? |
| InChIKey | BBPQUKDJGDQDOD-DURIUADWSA-N |
| XLogP | 2.53 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|