C20H13Cl2N3O5S — CID 172926146
[4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 172926146) has the molecular formula C20H13Cl2N3O5S and a molecular weight of 478.31 g/mol. Its IUPAC name is [4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 172926146 |
| Molecular Formula | C20H13Cl2N3O5S |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | [4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OC(=O)c3ccc(Cl)cc3Cl)cc2)NC1=O |
| InChI | InChI=1S/C20H13Cl2N3O5S/c1-29-17(26)9-16-18(27)24-20(31-16)25-23-10-11-2-5-13(6-3-11)30-19(28)14-7-4-12(21)8-15(14)22/h2-10H,1H3,(H,24,25,27)/b16-9+,23-10? |
| InChIKey | GZUCSFNBUFHWNA-JRYOGKSWSA-N |
| XLogP | 3.82 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|