C14H10ClN3O5S — CID 172926248
methyl (2E)-2-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926248) has the molecular formula C14H10ClN3O5S and a molecular weight of 367.77 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926248 |
| Molecular Formula | C14H10ClN3O5S |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc3c(cc2Cl)OCO3)NC1=O |
| InChI | InChI=1S/C14H10ClN3O5S/c1-21-12(19)4-11-13(20)17-14(24-11)18-16-5-7-2-9-10(3-8(7)15)23-6-22-9/h2-5H,6H2,1H3,(H,17,18,20)/b11-4+,16-5? |
| InChIKey | APDXWESRTQQTIZ-IYAVZAQNSA-N |
| XLogP | 1.68 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|