C17H17ClN4O3S — CID 172925313
methyl (2E)-2-[(2Z)-2-[(2-chloro-4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925313) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2-chloro-4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2-chloro-4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925313 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2-chloro-4-pyrrolidin-1-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(N3CCCC3)cc2Cl)NC1=O |
| InChI | InChI=1S/C17H17ClN4O3S/c1-25-15(23)9-14-16(24)20-17(26-14)21-19-10-11-4-5-12(8-13(11)18)22-6-2-3-7-22/h4-5,8-10H,2-3,6-7H2,1H3,(H,20,21,24)/b14-9+,19-10? |
| InChIKey | XNTSZCRFGOROAV-QCVPEABZSA-N |
| XLogP | 2.55 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|