C19H13Cl2N3O4S — CID 172925626
methyl (2E)-2-[(2Z)-2-[[4-(3,5-dichlorophenyl)-2-hydroxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925626) has the molecular formula C19H13Cl2N3O4S and a molecular weight of 450.30 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-(3,5-dichlorophenyl)-2-hydroxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-(3,5-dichlorophenyl)-2-hydroxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925626 |
| Molecular Formula | C19H13Cl2N3O4S |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-(3,5-dichlorophenyl)-2-hydroxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(-c3cc(Cl)cc(Cl)c3)cc2O)NC1=O |
| InChI | InChI=1S/C19H13Cl2N3O4S/c1-28-17(26)8-16-18(27)23-19(29-16)24-22-9-11-3-2-10(6-15(11)25)12-4-13(20)7-14(21)5-12/h2-9,25H,1H3,(H,23,24,27)/b16-8+,22-9? |
| InChIKey | XYUSZDUNSLCHGA-SJSHCKIXSA-N |
| XLogP | 3.98 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|