C14H13N3O6S2 — CID 172927253
methyl (2E)-2-[(2Z)-2-[(2-hydroxy-5-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927253) has the molecular formula C14H13N3O6S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2-hydroxy-5-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2-hydroxy-5-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927253 |
| Molecular Formula | C14H13N3O6S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2-hydroxy-5-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(S(C)(=O)=O)ccc2O)NC1=O |
| InChI | InChI=1S/C14H13N3O6S2/c1-23-12(19)6-11-13(20)16-14(24-11)17-15-7-8-5-9(25(2,21)22)3-4-10(8)18/h3-7,18H,1-2H3,(H,16,17,20)/b11-6+,15-7? |
| InChIKey | LWDCZBMQWCGYKF-QGXGEZINSA-N |
| XLogP | 0.41 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|