C13H11N3O9S3 — CID 172927007
2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,4-disulfonic acid (PubChem CID 172927007) has the molecular formula C13H11N3O9S3 and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 172927007 |
| Molecular Formula | C13H11N3O9S3 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzene-1,4-disulfonic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)NC1=O |
| InChI | InChI=1S/C13H11N3O9S3/c1-25-11(17)5-9-12(18)15-13(26-9)16-14-6-7-4-8(27(19,20)21)2-3-10(7)28(22,23)24/h2-6H,1H3,(H,15,16,18)(H,19,20,21)(H,22,23,24)/b9-5+,14-6? |
| InChIKey | ZWNBFRYRLULCLF-NJSJGLKASA-N |
| XLogP | -0.21 |
| TPSA | 188.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|