C15H12N4O7S — CID 172926727
methyl 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-6-nitrobenzoate (PubChem CID 172926727) has the molecular formula C15H12N4O7S and a molecular weight of 392.35 g/mol. Its IUPAC name is methyl 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-6-nitrobenzoate.
| Compound Name | methyl 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-6-nitrobenzoate |
|---|---|
| PubChem CID | 172926727 |
| Molecular Formula | C15H12N4O7S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | methyl 2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-6-nitrobenzoate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cccc([N+](=O)[O-])c2C(=O)OC)NC1=O |
| InChI | InChI=1S/C15H12N4O7S/c1-25-11(20)6-10-13(21)17-15(27-10)18-16-7-8-4-3-5-9(19(23)24)12(8)14(22)26-2/h3-7H,1-2H3,(H,17,18,21)/b10-6+,16-7? |
| InChIKey | ZPBBIPDEGUBCFF-ROXUELRJSA-N |
| XLogP | 0.99 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|