C14H9N5O5S — CID 172926633
methyl (2E)-2-[(2Z)-2-[(3-cyano-4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926633) has the molecular formula C14H9N5O5S and a molecular weight of 359.32 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(3-cyano-4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(3-cyano-4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926633 |
| Molecular Formula | C14H9N5O5S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(3-cyano-4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc([N+](=O)[O-])c(C#N)c2)NC1=O |
| InChI | InChI=1S/C14H9N5O5S/c1-24-12(20)5-11-13(21)17-14(25-11)18-16-7-8-2-3-10(19(22)23)9(4-8)6-15/h2-5,7H,1H3,(H,17,18,21)/b11-5+,16-7? |
| InChIKey | KAVWAYMOLQZEQC-WJAJPXGXSA-N |
| XLogP | 1.08 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|