C21H17N3O6S — CID 172926992
methyl (2E)-2-[(2Z)-2-[[6-(4-methoxyphenyl)-1,3-benzodioxol-5-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926992) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[6-(4-methoxyphenyl)-1,3-benzodioxol-5-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[6-(4-methoxyphenyl)-1,3-benzodioxol-5-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926992 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[6-(4-methoxyphenyl)-1,3-benzodioxol-5-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc3c(cc2-c2ccc(OC)cc2)OCO3)NC1=O |
| InChI | InChI=1S/C21H17N3O6S/c1-27-14-5-3-12(4-6-14)15-8-17-16(29-11-30-17)7-13(15)10-22-24-21-23-20(26)18(31-21)9-19(25)28-2/h3-10H,11H2,1-2H3,(H,23,24,26)/b18-9+,22-10? |
| InChIKey | WDOBIWFPMUXNRS-UYPHFLHSSA-N |
| XLogP | 2.70 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|