C21H19N3O5S2 — CID 172927247
methyl (2E)-2-[(2Z)-2-[[2-(2,5-dimethoxyphenyl)sulfanylphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927247) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[2-(2,5-dimethoxyphenyl)sulfanylphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[2-(2,5-dimethoxyphenyl)sulfanylphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927247 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[2-(2,5-dimethoxyphenyl)sulfanylphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccccc2Sc2cc(OC)ccc2OC)NC1=O |
| InChI | InChI=1S/C21H19N3O5S2/c1-27-14-8-9-15(28-2)17(10-14)30-16-7-5-4-6-13(16)12-22-24-21-23-20(26)18(31-21)11-19(25)29-3/h4-12H,1-3H3,(H,23,24,26)/b18-11+,22-12? |
| InChIKey | JXYKBWGKHANHEL-HJPMUZLHSA-N |
| XLogP | 3.46 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|