C12H10N4O3S2 — CID 135601476
[(E)-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea (PubChem CID 135601476) has the molecular formula C12H10N4O3S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is [(E)-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea.
| Compound Name | [(E)-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 135601476 |
| Molecular Formula | C12H10N4O3S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [(E)-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1\NC(=O)C(=Cc2ccc3c(c2)OCO3)S1 |
| InChI | InChI=1S/C12H10N4O3S2/c13-11(20)15-16-12-14-10(17)9(21-12)4-6-1-2-7-8(3-6)19-5-18-7/h1-4H,5H2,(H3,13,15,20)(H,14,16,17) |
| InChIKey | JDTOAGDXWYIGER-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|