C17H12N2O5S2 — CID 135602906
(NE)-N-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 135602906) has the molecular formula C17H12N2O5S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is (NE)-N-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-N-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 135602906 |
| Molecular Formula | C17H12N2O5S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (NE)-N-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | O=C1N/C(=N\S(=O)(=O)c2ccccc2)SC1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12N2O5S2/c20-16-15(9-11-6-7-13-14(8-11)24-10-23-13)25-17(18-16)19-26(21,22)12-4-2-1-3-5-12/h1-9H,10H2,(H,18,19,20) |
| InChIKey | WLBJPUQFDMSLNC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|