C16H12N2O4S2 — CID 135718425
(NE)-N-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 135718425) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (NE)-N-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-N-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 135718425 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (NE)-N-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | O=C1N/C(=N\S(=O)(=O)c2ccccc2)S/C1=C\c1ccccc1O |
| InChI | InChI=1S/C16H12N2O4S2/c19-13-9-5-4-6-11(13)10-14-15(20)17-16(23-14)18-24(21,22)12-7-2-1-3-8-12/h1-10,19H,(H,17,18,20)/b14-10- |
| InChIKey | JAHRYEKCGSCTLT-UVTDQMKNSA-N |
| XLogP | 2.34 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|