C17H14N2O5S2 — CID 135447187
N-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 135447187) has the molecular formula C17H14N2O5S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 135447187 |
| Molecular Formula | C17H14N2O5S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-[5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | COc1cc(C=C2SC(=NS(=O)(=O)c3ccccc3)NC2=O)ccc1O |
| InChI | InChI=1S/C17H14N2O5S2/c1-24-14-9-11(7-8-13(14)20)10-15-16(21)18-17(25-15)19-26(22,23)12-5-3-2-4-6-12/h2-10,20H,1H3,(H,18,19,21) |
| InChIKey | WBGDGYAVIFRHKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|