C18H15N3O7S2 — CID 135954523
N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 135954523) has the molecular formula C18H15N3O7S2 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 135954523 |
| Molecular Formula | C18H15N3O7S2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | COc1cc(/C=C2\SC(=NS(=O)(=O)c3ccccc3)NC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H15N3O7S2/c1-27-14-8-11(13(21(23)24)10-15(14)28-2)9-16-17(22)19-18(29-16)20-30(25,26)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,19,20,22)/b16-9- |
| InChIKey | DXPFGKPJCBOMGO-SXGWCWSVSA-N |
| XLogP | 2.56 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|