C19H15F2N3O5S — CID 135894797
(5Z)-5-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135894797) has the molecular formula C19H15F2N3O5S and a molecular weight of 435.41 g/mol. Its IUPAC name is (5Z)-5-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135894797 |
| Molecular Formula | C19H15F2N3O5S |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (5Z)-5-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cccc(C)c3)NC2=O)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H15F2N3O5S/c1-10-4-3-5-12(6-10)22-19-23-17(25)16(30-19)8-11-7-14(28-2)15(29-18(20)21)9-13(11)24(26)27/h3-9,18H,1-2H3,(H,22,23,25)/b16-8- |
| InChIKey | HRJIPYCNPPYPID-PXNMLYILSA-N |
| XLogP | 4.40 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|