C19H17N3O7S2 — CID 135896245
N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-1-phenylmethanesulfonamide (PubChem CID 135896245) has the molecular formula C19H17N3O7S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-1-phenylmethanesulfonamide.
| Compound Name | N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 135896245 |
| Molecular Formula | C19H17N3O7S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-1-phenylmethanesulfonamide |
| SMILES | COc1cc(/C=C2\SC(=NS(=O)(=O)Cc3ccccc3)NC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H17N3O7S2/c1-28-15-8-13(14(22(24)25)10-16(15)29-2)9-17-18(23)20-19(30-17)21-31(26,27)11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,20,21,23)/b17-9- |
| InChIKey | KFCKWSNPKIIHAM-MFOYZWKCSA-N |
| XLogP | 2.70 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|