C23H18N2O5S — CID 126108876
(2Z)-2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126108876) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is (2Z)-2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126108876 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2Z)-2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3NC2=O)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H18N2O5S/c1-29-19-11-16(12-22-23(26)24-17-9-5-6-10-21(17)31-22)18(25(27)28)13-20(19)30-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,24,26)/b22-12- |
| InChIKey | BBHTWVYSQKCLKE-UUYOSTAYSA-N |
| XLogP | 5.27 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|