C22H16N2O4S — CID 126102477
(2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126102477) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is (2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126102477 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1ccccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-22-21(29-20-8-4-2-6-18(20)23-22)13-16-5-1-3-7-19(16)28-14-15-9-11-17(12-10-15)24(26)27/h1-13H,14H2,(H,23,25)/b21-13- |
| InChIKey | JINUAZRVXIKNGP-BKUYFWCQSA-N |
| XLogP | 5.26 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|