C28H27N3O6S — CID 6141405
(5E)-5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-3-(3-methoxypropyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 6141405) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is (5E)-5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-3-(3-methoxypropyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-3-(3-methoxypropyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6141405 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | (5E)-5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-3-(3-methoxypropyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C\c2cc(OC)c(OCc3ccccc3)cc2[N+](=O)[O-])S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C28H27N3O6S/c1-35-15-9-14-30-27(32)26(38-28(30)29-22-12-7-4-8-13-22)17-21-16-24(36-2)25(18-23(21)31(33)34)37-19-20-10-5-3-6-11-20/h3-8,10-13,16-18H,9,14-15,19H2,1-2H3/b26-17+,29-28- |
| InChIKey | RFDQKEQTLFDDEN-GIEPNVOJSA-N |
| XLogP | 5.82 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|