C20H17N3O7S — CID 21227889
4-[[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 21227889) has the molecular formula C20H17N3O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is 4-[[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 21227889 |
| Molecular Formula | C20H17N3O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 4-[[(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(C(=O)O)cc3)N(C)C2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H17N3O7S/c1-22-18(24)17(31-20(22)21-13-6-4-11(5-7-13)19(25)26)9-12-8-15(29-2)16(30-3)10-14(12)23(27)28/h4-10H,1-3H3,(H,25,26)/b17-9-,21-20+ |
| InChIKey | ONRISKLWSQEBMS-VFWVXXFISA-N |
| XLogP | 3.54 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|