C21H19N3O7S — CID 4772055
ethyl 4-[[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4772055) has the molecular formula C21H19N3O7S and a molecular weight of 457.46 g/mol. Its IUPAC name is ethyl 4-[[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4772055 |
| Molecular Formula | C21H19N3O7S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | ethyl 4-[[5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(=Cc3cc(OC)c(O)c([N+](=O)[O-])c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C21H19N3O7S/c1-4-31-20(27)13-5-7-14(8-6-13)22-21-23(2)19(26)17(32-21)11-12-9-15(24(28)29)18(25)16(10-12)30-3/h5-11,25H,4H2,1-3H3/b17-11?,22-21- |
| InChIKey | ZGPNCMADLQIJJD-NAQCKGPDSA-N |
| XLogP | 3.72 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|