C24H23ClN2O5S — CID 4765627
ethyl 4-[[5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4765627) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is ethyl 4-[[5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4765627 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | ethyl 4-[[5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | C=CCOc1c(Cl)cc(C=C2S/C(=N/c3ccc(C(=O)OCC)cc3)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C24H23ClN2O5S/c1-5-11-32-21-18(25)12-15(13-19(21)30-4)14-20-22(28)27(3)24(33-20)26-17-9-7-16(8-10-17)23(29)31-6-2/h5,7-10,12-14H,1,6,11H2,2-4H3/b20-14?,26-24+ |
| InChIKey | SPESGAVVPUEUEB-HRODLFPZSA-N |
| XLogP | 5.32 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|