C23H21ClN2O5S — CID 6210523
4-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 6210523) has the molecular formula C23H21ClN2O5S and a molecular weight of 472.95 g/mol. Its IUPAC name is 4-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 6210523 |
| Molecular Formula | C23H21ClN2O5S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 4-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\S/C(=N/c3ccc(C(=O)O)cc3)N(C)C2=O)cc1OCC |
| InChI | InChI=1S/C23H21ClN2O5S/c1-4-10-31-20-17(24)11-14(12-18(20)30-5-2)13-19-21(27)26(3)23(32-19)25-16-8-6-15(7-9-16)22(28)29/h4,6-9,11-13H,1,5,10H2,2-3H3,(H,28,29)/b19-13-,25-23+ |
| InChIKey | QSPBKBOTUAPDCN-JEPJVFCJSA-N |
| XLogP | 5.24 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|