C21H14Cl2N2O4S — CID 4193712
4-[[5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4193712) has the molecular formula C21H14Cl2N2O4S and a molecular weight of 461.33 g/mol. Its IUPAC name is 4-[[5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4193712 |
| Molecular Formula | C21H14Cl2N2O4S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 4-[[5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C#CCOc1c(Cl)cc(C=C2S/C(=N/c3ccc(C(=O)O)cc3)N(C)C2=O)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O4S/c1-3-8-29-18-15(22)9-12(10-16(18)23)11-17-19(26)25(2)21(30-17)24-14-6-4-13(5-7-14)20(27)28/h1,4-7,9-11H,8H2,2H3,(H,27,28)/b17-11?,24-21+ |
| InChIKey | BJJVDKNJTZUHNA-VQVPPQOTSA-N |
| XLogP | 4.94 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|