C23H19Cl3N2O2S — CID 126089923
(5Z)-2-(4-chlorophenyl)imino-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one (PubChem CID 126089923) has the molecular formula C23H19Cl3N2O2S and a molecular weight of 493.84 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126089923 |
| Molecular Formula | C23H19Cl3N2O2S |
| Molecular Weight | 493.84 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(Cl)cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)N(CC(C)C)C2=O)cc1Cl |
| InChI | InChI=1S/C23H19Cl3N2O2S/c1-4-9-30-21-18(25)10-15(11-19(21)26)12-20-22(29)28(13-14(2)3)23(31-20)27-17-7-5-16(24)6-8-17/h1,5-8,10-12,14H,9,13H2,2-3H3/b20-12-,27-23+ |
| InChIKey | VJWYGWWNRXNQGJ-IKKNYDNDSA-N |
| XLogP | 6.92 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.84 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|