C28H22Br2ClN3O2S — CID 126085137
2-[[2,6-dibromo-4-[(Z)-[2-(4-chlorophenyl)imino-3-(2-methylpropyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126085137) has the molecular formula C28H22Br2ClN3O2S and a molecular weight of 659.83 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-[(Z)-[2-(4-chlorophenyl)imino-3-(2-methylpropyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dibromo-4-[(Z)-[2-(4-chlorophenyl)imino-3-(2-methylpropyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126085137 |
| Molecular Formula | C28H22Br2ClN3O2S |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 656.95 |
| IUPAC Name | 2-[[2,6-dibromo-4-[(Z)-[2-(4-chlorophenyl)imino-3-(2-methylpropyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CC(C)CN1C(=O)/C(=C/c2cc(Br)c(OCc3ccccc3C#N)c(Br)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H22Br2ClN3O2S/c1-17(2)15-34-27(35)25(37-28(34)33-22-9-7-21(31)8-10-22)13-18-11-23(29)26(24(30)12-18)36-16-20-6-4-3-5-19(20)14-32/h3-13,17H,15-16H2,1-2H3/b25-13-,33-28+ |
| InChIKey | CYVBIYIFZUHCLR-LUVAXQEKSA-N |
| XLogP | 8.58 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|