C27H22Br2Cl2N2O2S — CID 126089607
(5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one (PubChem CID 126089607) has the molecular formula C27H22Br2Cl2N2O2S and a molecular weight of 669.27 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126089607 |
| Molecular Formula | C27H22Br2Cl2N2O2S |
| Molecular Weight | 669.27 g/mol |
| Exact Mass | 665.91 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)CN1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Br2Cl2N2O2S/c1-16(2)14-33-26(34)24(36-27(33)32-21-9-7-20(31)8-10-21)13-18-11-22(28)25(23(29)12-18)35-15-17-3-5-19(30)6-4-17/h3-13,16H,14-15H2,1-2H3/b24-13-,32-27+ |
| InChIKey | SESIHSHHGZBSBX-VDGOXKQWSA-N |
| XLogP | 9.36 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.27 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|