C27H21Cl2FN2O4S — CID 4764570
ethyl 4-[[5-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4764570) has the molecular formula C27H21Cl2FN2O4S and a molecular weight of 559.45 g/mol. Its IUPAC name is ethyl 4-[[5-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[5-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4764570 |
| Molecular Formula | C27H21Cl2FN2O4S |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | ethyl 4-[[5-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/SC(=Cc3cc(Cl)c(OCc4ccc(F)cc4)c(Cl)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H21Cl2FN2O4S/c1-3-35-26(34)18-6-10-20(11-7-18)31-27-32(2)25(33)23(37-27)14-17-12-21(28)24(22(29)13-17)36-15-16-4-8-19(30)9-5-16/h4-14H,3,15H2,1-2H3/b23-14?,31-27+ |
| InChIKey | DCTBUPLCMUFUAA-WHOAFKQBSA-N |
| XLogP | 7.12 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|