C23H21BrN2O4S — CID 3604637
5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3604637) has the molecular formula C23H21BrN2O4S and a molecular weight of 501.40 g/mol. Its IUPAC name is 5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3604637 |
| Molecular Formula | C23H21BrN2O4S |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1cc(Br)c(C=C2S/C(=N\c3ccccc3)N(CCOC)C2=O)cc1OC |
| InChI | InChI=1S/C23H21BrN2O4S/c1-4-11-30-20-15-18(24)16(13-19(20)29-3)14-21-22(27)26(10-12-28-2)23(31-21)25-17-8-6-5-7-9-17/h1,5-9,13-15H,10-12H2,2-3H3/b21-14?,25-23- |
| InChIKey | SXPSNPIFGOZFFN-DXHRAYGNSA-N |
| XLogP | 4.72 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|