C19H18N2O6S2 — CID 135771463
(NE)-N-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 135771463) has the molecular formula C19H18N2O6S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is (NE)-N-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NE)-N-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135771463 |
| Molecular Formula | C19H18N2O6S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | (NE)-N-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C2\NC(=O)C(=Cc3ccc(OC)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C19H18N2O6S2/c1-25-13-5-7-14(8-6-13)29(23,24)21-19-20-18(22)17(28-19)11-12-4-9-15(26-2)16(10-12)27-3/h4-11H,1-3H3,(H,20,21,22) |
| InChIKey | VSLWZOAAGQJVJC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|