C19H18N2O5S2 — CID 4617574
N-[3-ethyl-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 4617574) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[3-ethyl-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[3-ethyl-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 4617574 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[3-ethyl-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CCN1C(=O)C(=Cc2ccc(O)c(OC)c2)SC1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S2/c1-3-21-18(23)17(12-13-9-10-15(22)16(11-13)26-2)27-19(21)20-28(24,25)14-7-5-4-6-8-14/h4-12,22H,3H2,1-2H3 |
| InChIKey | YYXLTMOUHNJPID-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|