C17H11IN2O3S — CID 137063127
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-iodophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137063127) has the molecular formula C17H11IN2O3S and a molecular weight of 450.26 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-iodophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-iodophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137063127 |
| Molecular Formula | C17H11IN2O3S |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-iodophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2I)S/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11IN2O3S/c18-11-3-1-2-4-12(11)19-17-20-16(21)15(24-17)8-10-5-6-13-14(7-10)23-9-22-13/h1-8H,9H2,(H,19,20,21)/b15-8+ |
| InChIKey | OSXRCRLATBJANK-OVCLIPMQSA-N |
| XLogP | 3.91 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|